C17H17N5 — CID 175967157
5-(1H-indazol-6-yl)-1-propan-2-ylindazol-3-amine (PubChem CID 175967157) has the molecular formula C17H17N5 and a molecular weight of 291.36 g/mol. Its IUPAC name is 5-(1H-indazol-6-yl)-1-propan-2-ylindazol-3-amine.
| Compound Name | 5-(1H-indazol-6-yl)-1-propan-2-ylindazol-3-amine |
|---|---|
| PubChem CID | 175967157 |
| Molecular Formula | C17H17N5 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 5-(1H-indazol-6-yl)-1-propan-2-ylindazol-3-amine |
| SMILES | CC(C)n1nc(N)c2cc(-c3ccc4cn[nH]c4c3)ccc21 |
| InChI | InChI=1S/C17H17N5/c1-10(2)22-16-6-5-11(7-14(16)17(18)21-22)12-3-4-13-9-19-20-15(13)8-12/h3-10H,1-2H3,(H2,18,21)(H,19,20) |
| InChIKey | AWWUFJASJAWWNH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |