About 9-(1,5-dimethylpyrazol-3-yl)-8-methyl-N-[(3-methylphenyl)methylideneamino]purin-6-amine
9-(1,5-dimethylpyrazol-3-yl)-8-methyl-N-[(3-methylphenyl)methylideneamino]purin-6-amine (PubChem CID 175967432) has the molecular formula C19H20N8
and a molecular weight of 360.43 g/mol. Its IUPAC name is 9-(1,5-dimethylpyrazol-3-yl)-8-methyl-N-[(3-methylphenyl)methylideneamino]purin-6-amine.
Molecular Properties
| Compound Name | 9-(1,5-dimethylpyrazol-3-yl)-8-methyl-N-[(3-methylphenyl)methylideneamino]purin-6-amine |
| PubChem CID | 175967432 |
| Molecular Formula | C19H20N8 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 9-(1,5-dimethylpyrazol-3-yl)-8-methyl-N-[(3-methylphenyl)methylideneamino]purin-6-amine |
| SMILES | Cc1cccc(C=NNc2ncnc3c2nc(C)n3-c2cc(C)n(C)n2)c1 |
| InChI | InChI=1S/C19H20N8/c1-12-6-5-7-15(8-12)10-22-24-18-17-19(21-11-20-18)27(14(3)23-17)16-9-13(2)26(4)25-16/h5-11H,1-4H3,(H,20,21,24) |
| InChIKey | WOJCNXJYYKCGKD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-(1,5-dimethylpyrazol-3-yl)-8-methyl-N-[(3-methylphenyl)methylideneamino]purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(1,5-dimethylpyrazol-3-yl)-8-methyl-N-[(3-methylphenyl)methylideneamino]purin-6-amine?
The IUPAC name of 9-(1,5-dimethylpyrazol-3-yl)-8-methyl-N-[(3-methylphenyl)methylideneamino]purin-6-amine (CID 175967432) is 9-(1,5-dimethylpyrazol-3-yl)-8-methyl-N-[(3-methylphenyl)methylideneamino]purin-6-amine.
What is the SMILES notation for 9-(1,5-dimethylpyrazol-3-yl)-8-methyl-N-[(3-methylphenyl)methylideneamino]purin-6-amine?
The canonical SMILES for 9-(1,5-dimethylpyrazol-3-yl)-8-methyl-N-[(3-methylphenyl)methylideneamino]purin-6-amine is Cc1cccc(C=NNc2ncnc3c2nc(C)n3-c2cc(C)n(C)n2)c1.
What is the InChIKey of 9-(1,5-dimethylpyrazol-3-yl)-8-methyl-N-[(3-methylphenyl)methylideneamino]purin-6-amine?
The InChIKey is WOJCNXJYYKCGKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N8/c1-12-6-5-7-15(8-12)10-22-24-18-17-19(21-11-20-18)27(14(3)23-17)16-9-13(2)26(4)25-16/h5-11H,1-4H3,(H,20,21,24).
What are the key properties of 9-(1,5-dimethylpyrazol-3-yl)-8-methyl-N-[(3-methylphenyl)methylideneamino]purin-6-amine?
9-(1,5-dimethylpyrazol-3-yl)-8-methyl-N-[(3-methylphenyl)methylideneamino]purin-6-amine has a molecular weight of 360.43 g/mol, XLogP of 2.92, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(1,5-dimethylpyrazol-3-yl)-8-methyl-N-[(3-methylphenyl)methylideneamino]purin-6-amine is sourced from PubChem (CID 175967432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).