C25H39N3O4Si — CID 175968133
benzyl-[1-tert-butyl-3-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]pyrazol-5-yl]carbamic acid (PubChem CID 175968133) has the molecular formula C25H39N3O4Si and a molecular weight of 473.69 g/mol. Its IUPAC name is benzyl-[1-tert-butyl-3-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]pyrazol-5-yl]carbamic acid.
| Compound Name | benzyl-[1-tert-butyl-3-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]pyrazol-5-yl]carbamic acid |
|---|---|
| PubChem CID | 175968133 |
| Molecular Formula | C25H39N3O4Si |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | benzyl-[1-tert-butyl-3-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]pyrazol-5-yl]carbamic acid |
| SMILES | CC(C)(C)n1nc([C@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)CO2)cc1N(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H39N3O4Si/c1-24(2,3)28-22(27(23(29)30)16-18-12-10-9-11-13-18)15-20(26-28)21-14-19(17-31-21)32-33(7,8)25(4,5)6/h9-13,15,19,21H,14,16-17H2,1-8H3,(H,29,30)/t19-,21-/m1/s1 |
| InChIKey | XEZBKICEBLLBBW-TZIWHRDSSA-N |
| XLogP | 6.17 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|