About 5-methyl-2H-pyran-2,3,4-triol
5-methyl-2H-pyran-2,3,4-triol (PubChem CID 175968170) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is 5-methyl-2H-pyran-2,3,4-triol.
Molecular Properties
| Compound Name | 5-methyl-2H-pyran-2,3,4-triol |
| PubChem CID | 175968170 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 5-methyl-2H-pyran-2,3,4-triol |
| SMILES | CC1=COC(O)C(O)=C1O |
| InChI | InChI=1S/C6H8O4/c1-3-2-10-6(9)5(8)4(3)7/h2,6-9H,1H3 |
| InChIKey | HQKWCMDLGLKOGR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-2H-pyran-2,3,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2H-pyran-2,3,4-triol?
The IUPAC name of 5-methyl-2H-pyran-2,3,4-triol (CID 175968170) is 5-methyl-2H-pyran-2,3,4-triol.
What is the SMILES notation for 5-methyl-2H-pyran-2,3,4-triol?
The canonical SMILES for 5-methyl-2H-pyran-2,3,4-triol is CC1=COC(O)C(O)=C1O.
What is the InChIKey of 5-methyl-2H-pyran-2,3,4-triol?
The InChIKey is HQKWCMDLGLKOGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4/c1-3-2-10-6(9)5(8)4(3)7/h2,6-9H,1H3.
What are the key properties of 5-methyl-2H-pyran-2,3,4-triol?
5-methyl-2H-pyran-2,3,4-triol has a molecular weight of 144.13 g/mol, XLogP of 0.57, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2H-pyran-2,3,4-triol is sourced from PubChem (CID 175968170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).