About (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) hydrogen sulfate;hydrate
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) hydrogen sulfate;hydrate (PubChem CID 175968176) has the molecular formula C8H17NO5S
and a molecular weight of 239.29 g/mol. Its IUPAC name is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) hydrogen sulfate;hydrate.
Molecular Properties
| Compound Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) hydrogen sulfate;hydrate |
| PubChem CID | 175968176 |
| Molecular Formula | C8H17NO5S |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) hydrogen sulfate;hydrate |
| SMILES | CN1C2CCC1CC(OS(=O)(=O)O)C2.O |
| InChI | InChI=1S/C8H15NO4S.H2O/c1-9-6-2-3-7(9)5-8(4-6)13-14(10,11)12;/h6-8H,2-5H2,1H3,(H,10,11,12);1H2 |
| InChIKey | CVKGLBNJJPHBEC-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) hydrogen sulfate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) hydrogen sulfate;hydrate?
The IUPAC name of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) hydrogen sulfate;hydrate (CID 175968176) is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) hydrogen sulfate;hydrate.
What is the SMILES notation for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) hydrogen sulfate;hydrate?
The canonical SMILES for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) hydrogen sulfate;hydrate is CN1C2CCC1CC(OS(=O)(=O)O)C2.O.
What is the InChIKey of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) hydrogen sulfate;hydrate?
The InChIKey is CVKGLBNJJPHBEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4S.H2O/c1-9-6-2-3-7(9)5-8(4-6)13-14(10,11)12;/h6-8H,2-5H2,1H3,(H,10,11,12);1H2.
What are the key properties of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) hydrogen sulfate;hydrate?
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) hydrogen sulfate;hydrate has a molecular weight of 239.29 g/mol, XLogP of -0.39, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) hydrogen sulfate;hydrate is sourced from PubChem (CID 175968176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).