About [1-[3-[(2,6-difluorophenyl)diazenyl]phenyl]-2-methylpropan-2-yl] carbamate
[1-[3-[(2,6-difluorophenyl)diazenyl]phenyl]-2-methylpropan-2-yl] carbamate (PubChem CID 175968596) has the molecular formula C17H17F2N3O2
and a molecular weight of 333.34 g/mol. Its IUPAC name is [1-[3-[(2,6-difluorophenyl)diazenyl]phenyl]-2-methylpropan-2-yl] carbamate.
Molecular Properties
| Compound Name | [1-[3-[(2,6-difluorophenyl)diazenyl]phenyl]-2-methylpropan-2-yl] carbamate |
| PubChem CID | 175968596 |
| Molecular Formula | C17H17F2N3O2 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | [1-[3-[(2,6-difluorophenyl)diazenyl]phenyl]-2-methylpropan-2-yl] carbamate |
| SMILES | CC(C)(Cc1cccc(/N=N/c2c(F)cccc2F)c1)OC(N)=O |
| InChI | InChI=1S/C17H17F2N3O2/c1-17(2,24-16(20)23)10-11-5-3-6-12(9-11)21-22-15-13(18)7-4-8-14(15)19/h3-9H,10H2,1-2H3,(H2,20,23)/b22-21+ |
| InChIKey | STDUQPACNFODDY-QURGRASLSA-N |
| XLogP | 4.80 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [1-[3-[(2,6-difluorophenyl)diazenyl]phenyl]-2-methylpropan-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-[(2,6-difluorophenyl)diazenyl]phenyl]-2-methylpropan-2-yl] carbamate?
The IUPAC name of [1-[3-[(2,6-difluorophenyl)diazenyl]phenyl]-2-methylpropan-2-yl] carbamate (CID 175968596) is [1-[3-[(2,6-difluorophenyl)diazenyl]phenyl]-2-methylpropan-2-yl] carbamate.
What is the SMILES notation for [1-[3-[(2,6-difluorophenyl)diazenyl]phenyl]-2-methylpropan-2-yl] carbamate?
The canonical SMILES for [1-[3-[(2,6-difluorophenyl)diazenyl]phenyl]-2-methylpropan-2-yl] carbamate is CC(C)(Cc1cccc(/N=N/c2c(F)cccc2F)c1)OC(N)=O.
What is the InChIKey of [1-[3-[(2,6-difluorophenyl)diazenyl]phenyl]-2-methylpropan-2-yl] carbamate?
The InChIKey is STDUQPACNFODDY-QURGRASLSA-N. The full InChI is InChI=1S/C17H17F2N3O2/c1-17(2,24-16(20)23)10-11-5-3-6-12(9-11)21-22-15-13(18)7-4-8-14(15)19/h3-9H,10H2,1-2H3,(H2,20,23)/b22-21+.
What are the key properties of [1-[3-[(2,6-difluorophenyl)diazenyl]phenyl]-2-methylpropan-2-yl] carbamate?
[1-[3-[(2,6-difluorophenyl)diazenyl]phenyl]-2-methylpropan-2-yl] carbamate has a molecular weight of 333.34 g/mol, XLogP of 4.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-[(2,6-difluorophenyl)diazenyl]phenyl]-2-methylpropan-2-yl] carbamate is sourced from PubChem (CID 175968596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).