C20H28N2O8 — CID 175969101
2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-[2-(phenylmethoxycarbonylamino)ethoxy]pentanoic acid (PubChem CID 175969101) has the molecular formula C20H28N2O8 and a molecular weight of 424.45 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-[2-(phenylmethoxycarbonylamino)ethoxy]pentanoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-[2-(phenylmethoxycarbonylamino)ethoxy]pentanoic acid |
|---|---|
| PubChem CID | 175969101 |
| Molecular Formula | C20H28N2O8 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-[2-(phenylmethoxycarbonylamino)ethoxy]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)OCCNC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H28N2O8/c1-20(2,3)30-19(27)22-15(17(24)25)9-10-16(23)28-12-11-21-18(26)29-13-14-7-5-4-6-8-14/h4-8,15H,9-13H2,1-3H3,(H,21,26)(H,22,27)(H,24,25) |
| InChIKey | XTCJBGBXTGKNSR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|