About 2-[5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-1,4-oxaphosphinan-4-ium 4-oxide
2-[5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-1,4-oxaphosphinan-4-ium 4-oxide (PubChem CID 175969126) has the molecular formula C19H15Cl2FN2O2P+
and a molecular weight of 424.22 g/mol. Its IUPAC name is 2-[5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-1,4-oxaphosphinan-4-ium 4-oxide.
Molecular Properties
| Compound Name | 2-[5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-1,4-oxaphosphinan-4-ium 4-oxide |
| PubChem CID | 175969126 |
| Molecular Formula | C19H15Cl2FN2O2P+ |
| Molecular Weight | 424.22 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | 2-[5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-1,4-oxaphosphinan-4-ium 4-oxide |
| SMILES | Cc1nc2cc(F)c(-c3ccc(C4C[P+](=O)CCO4)nc3)cc2c(Cl)c1Cl |
| InChI | InChI=1S/C19H15Cl2FN2O2P/c1-10-18(20)19(21)13-6-12(14(22)7-16(13)24-10)11-2-3-15(23-8-11)17-9-27(25)5-4-26-17/h2-3,6-8,17H,4-5,9H2,1H3/q+1 |
| InChIKey | XFTWZIIBRJUQIS-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.22 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-1,4-oxaphosphinan-4-ium 4-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-1,4-oxaphosphinan-4-ium 4-oxide?
The IUPAC name of 2-[5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-1,4-oxaphosphinan-4-ium 4-oxide (CID 175969126) is 2-[5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-1,4-oxaphosphinan-4-ium 4-oxide.
What is the SMILES notation for 2-[5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-1,4-oxaphosphinan-4-ium 4-oxide?
The canonical SMILES for 2-[5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-1,4-oxaphosphinan-4-ium 4-oxide is Cc1nc2cc(F)c(-c3ccc(C4C[P+](=O)CCO4)nc3)cc2c(Cl)c1Cl.
What is the InChIKey of 2-[5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-1,4-oxaphosphinan-4-ium 4-oxide?
The InChIKey is XFTWZIIBRJUQIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15Cl2FN2O2P/c1-10-18(20)19(21)13-6-12(14(22)7-16(13)24-10)11-2-3-15(23-8-11)17-9-27(25)5-4-26-17/h2-3,6-8,17H,4-5,9H2,1H3/q+1.
What are the key properties of 2-[5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-1,4-oxaphosphinan-4-ium 4-oxide?
2-[5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-1,4-oxaphosphinan-4-ium 4-oxide has a molecular weight of 424.22 g/mol, XLogP of 5.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-1,4-oxaphosphinan-4-ium 4-oxide is sourced from PubChem (CID 175969126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).