C20H24N2O4 — CID 175969260
2-[[4-(naphthalen-1-ylamino)-4-oxobutanoyl]amino]hexanoic acid (PubChem CID 175969260) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-[[4-(naphthalen-1-ylamino)-4-oxobutanoyl]amino]hexanoic acid.
| Compound Name | 2-[[4-(naphthalen-1-ylamino)-4-oxobutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175969260 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-[[4-(naphthalen-1-ylamino)-4-oxobutanoyl]amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)CCC(=O)Nc1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C20H24N2O4/c1-2-3-10-17(20(25)26)22-19(24)13-12-18(23)21-16-11-6-8-14-7-4-5-9-15(14)16/h4-9,11,17H,2-3,10,12-13H2,1H3,(H,21,23)(H,22,24)(H,25,26) |
| InChIKey | IVOAMONIGYKKFF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |