About (2S)-2,6-diaminohexanoic acid;trifluoromethanesulfonic acid
(2S)-2,6-diaminohexanoic acid;trifluoromethanesulfonic acid (PubChem CID 175969375) has the molecular formula C7H15F3N2O5S
and a molecular weight of 296.27 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | (2S)-2,6-diaminohexanoic acid;trifluoromethanesulfonic acid |
| PubChem CID | 175969375 |
| Molecular Formula | C7H15F3N2O5S |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;trifluoromethanesulfonic acid |
| SMILES | NCCCC[C@H](N)C(=O)O.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C6H14N2O2.CHF3O3S/c7-4-2-1-3-5(8)6(9)10;2-1(3,4)8(5,6)7/h5H,1-4,7-8H2,(H,9,10);(H,5,6,7)/t5-;/m0./s1 |
| InChIKey | MNCLZLXWZARXHL-JEDNCBNOSA-N |
| XLogP | -0.08 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,6-diaminohexanoic acid;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,6-diaminohexanoic acid;trifluoromethanesulfonic acid?
The IUPAC name of (2S)-2,6-diaminohexanoic acid;trifluoromethanesulfonic acid (CID 175969375) is (2S)-2,6-diaminohexanoic acid;trifluoromethanesulfonic acid.
What is the SMILES notation for (2S)-2,6-diaminohexanoic acid;trifluoromethanesulfonic acid?
The canonical SMILES for (2S)-2,6-diaminohexanoic acid;trifluoromethanesulfonic acid is NCCCC[C@H](N)C(=O)O.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of (2S)-2,6-diaminohexanoic acid;trifluoromethanesulfonic acid?
The InChIKey is MNCLZLXWZARXHL-JEDNCBNOSA-N. The full InChI is InChI=1S/C6H14N2O2.CHF3O3S/c7-4-2-1-3-5(8)6(9)10;2-1(3,4)8(5,6)7/h5H,1-4,7-8H2,(H,9,10);(H,5,6,7)/t5-;/m0./s1.
What are the key properties of (2S)-2,6-diaminohexanoic acid;trifluoromethanesulfonic acid?
(2S)-2,6-diaminohexanoic acid;trifluoromethanesulfonic acid has a molecular weight of 296.27 g/mol, XLogP of -0.08, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,6-diaminohexanoic acid;trifluoromethanesulfonic acid is sourced from PubChem (CID 175969375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).