C14H15Cl4N5 — CID 175969487
6,7-dichloro-10-(1H-pyrazol-4-yl)-1,2,3,4-tetrahydropyrazino[1,2-a]indol-9-amine;dihydrochloride (PubChem CID 175969487) has the molecular formula C14H15Cl4N5 and a molecular weight of 395.12 g/mol. Its IUPAC name is 6,7-dichloro-10-(1H-pyrazol-4-yl)-1,2,3,4-tetrahydropyrazino[1,2-a]indol-9-amine;dihydrochloride.
| Compound Name | 6,7-dichloro-10-(1H-pyrazol-4-yl)-1,2,3,4-tetrahydropyrazino[1,2-a]indol-9-amine;dihydrochloride |
|---|---|
| PubChem CID | 175969487 |
| Molecular Formula | C14H15Cl4N5 |
| Molecular Weight | 395.12 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 6,7-dichloro-10-(1H-pyrazol-4-yl)-1,2,3,4-tetrahydropyrazino[1,2-a]indol-9-amine;dihydrochloride |
| SMILES | Cl.Cl.Nc1cc(Cl)c(Cl)c2c1c(-c1cn[nH]c1)c1n2CCNC1 |
| InChI | InChI=1S/C14H13Cl2N5.2ClH/c15-8-3-9(17)12-11(7-4-19-20-5-7)10-6-18-1-2-21(10)14(12)13(8)16;;/h3-5,18H,1-2,6,17H2,(H,19,20);2*1H |
| InChIKey | YTRKNOFGWPTEMB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.12 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|