C22H33N3O2 — CID 175969865
(1R,2S,5S)-3-[2-[(3-butoxy-1-adamantyl)amino]acetyl]-3-azabicyclo[3.1.0]hexane-2-carbonitrile (PubChem CID 175969865) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is (1R,2S,5S)-3-[2-[(3-butoxy-1-adamantyl)amino]acetyl]-3-azabicyclo[3.1.0]hexane-2-carbonitrile.
| Compound Name | (1R,2S,5S)-3-[2-[(3-butoxy-1-adamantyl)amino]acetyl]-3-azabicyclo[3.1.0]hexane-2-carbonitrile |
|---|---|
| PubChem CID | 175969865 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | (1R,2S,5S)-3-[2-[(3-butoxy-1-adamantyl)amino]acetyl]-3-azabicyclo[3.1.0]hexane-2-carbonitrile |
| SMILES | CCCCOC12CC3CC(CC(NCC(=O)N4C[C@H]5C[C@H]5[C@H]4C#N)(C3)C1)C2 |
| InChI | InChI=1S/C22H33N3O2/c1-2-3-4-27-22-9-15-5-16(10-22)8-21(7-15,14-22)24-12-20(26)25-13-17-6-18(17)19(25)11-23/h15-19,24H,2-10,12-14H2,1H3/t15?,16?,17-,18-,19-,21?,22?/m1/s1 |
| InChIKey | VVXKECOOONTRBC-MDADBXLFSA-N |
| XLogP | 2.85 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|