C30H35F3N4O4 — CID 175970094
(3Z)-1-[(4-aminocyclohexyl)methyl]-3-[(3,5-diethyl-1H-pyrrol-2-yl)methylidene]-2-oxo-N-prop-2-ynylindole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 175970094) has the molecular formula C30H35F3N4O4 and a molecular weight of 572.63 g/mol. Its IUPAC name is (3Z)-1-[(4-aminocyclohexyl)methyl]-3-[(3,5-diethyl-1H-pyrrol-2-yl)methylidene]-2-oxo-N-prop-2-ynylindole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3Z)-1-[(4-aminocyclohexyl)methyl]-3-[(3,5-diethyl-1H-pyrrol-2-yl)methylidene]-2-oxo-N-prop-2-ynylindole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175970094 |
| Molecular Formula | C30H35F3N4O4 |
| Molecular Weight | 572.63 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | (3Z)-1-[(4-aminocyclohexyl)methyl]-3-[(3,5-diethyl-1H-pyrrol-2-yl)methylidene]-2-oxo-N-prop-2-ynylindole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | C#CCNC(=O)c1ccc2c(c1)/C(=C/c1[nH]c(CC)cc1CC)C(=O)N2CC1CCC(N)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H34N4O2.C2HF3O2/c1-4-13-30-27(33)20-9-12-26-23(15-20)24(16-25-19(5-2)14-22(6-3)31-25)28(34)32(26)17-18-7-10-21(29)11-8-18;3-2(4,5)1(6)7/h1,9,12,14-16,18,21,31H,5-8,10-11,13,17,29H2,2-3H3,(H,30,33);(H,6,7)/b24-16-; |
| InChIKey | ZSWCPSDQIBDPMT-PNNXLEGYSA-N |
| XLogP | 4.54 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|