C17H24Zr — CID 175970554
2-propylcyclopenta-1,3-diene;1,2,3,5-tetramethylcyclopenta-1,3-diene;zirconium(2+) (PubChem CID 175970554) has the molecular formula C17H24Zr and a molecular weight of 319.60 g/mol. Its IUPAC name is 2-propylcyclopenta-1,3-diene;1,2,3,5-tetramethylcyclopenta-1,3-diene;zirconium(2+).
| Compound Name | 2-propylcyclopenta-1,3-diene;1,2,3,5-tetramethylcyclopenta-1,3-diene;zirconium(2+) |
|---|---|
| PubChem CID | 175970554 |
| Molecular Formula | C17H24Zr |
| Molecular Weight | 319.60 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-propylcyclopenta-1,3-diene;1,2,3,5-tetramethylcyclopenta-1,3-diene;zirconium(2+) |
| SMILES | CCCC1=[C-]CC=C1.Cc1c[c-](C)c(C)c1C.[Zr+2] |
| InChI | InChI=1S/C9H13.C8H11.Zr/c1-6-5-7(2)9(4)8(6)3;1-2-5-8-6-3-4-7-8;/h5H,1-4H3;3,6H,2,4-5H2,1H3;/q2*-1;+2 |
| InChIKey | CCOXTQXTZOBCCZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|