C26H47N3O6 — CID 175971754
3-[2-(dimethylamino)acetyl]-12-hydroxy-11-methoxy-7,9,11,13,15,15-hexamethyl-17-oxa-3,7-diazaspiro[5.12]octadecane-14,16-dione (PubChem CID 175971754) has the molecular formula C26H47N3O6 and a molecular weight of 497.68 g/mol. Its IUPAC name is 3-[2-(dimethylamino)acetyl]-12-hydroxy-11-methoxy-7,9,11,13,15,15-hexamethyl-17-oxa-3,7-diazaspiro[5.12]octadecane-14,16-dione.
| Compound Name | 3-[2-(dimethylamino)acetyl]-12-hydroxy-11-methoxy-7,9,11,13,15,15-hexamethyl-17-oxa-3,7-diazaspiro[5.12]octadecane-14,16-dione |
|---|---|
| PubChem CID | 175971754 |
| Molecular Formula | C26H47N3O6 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.35 |
| IUPAC Name | 3-[2-(dimethylamino)acetyl]-12-hydroxy-11-methoxy-7,9,11,13,15,15-hexamethyl-17-oxa-3,7-diazaspiro[5.12]octadecane-14,16-dione |
| SMILES | COC1(C)CC(C)CN(C)C2(CCN(C(=O)CN(C)C)CC2)COC(=O)C(C)(C)C(=O)C(C)C1O |
| InChI | InChI=1S/C26H47N3O6/c1-18-14-25(5,34-9)22(32)19(2)21(31)24(3,4)23(33)35-17-26(28(8)15-18)10-12-29(13-11-26)20(30)16-27(6)7/h18-19,22,32H,10-17H2,1-9H3 |
| InChIKey | FWEGRCBABYDZDA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|