C19H17BrClF3N4O2S2 — CID 175971929
6-[(1S,6S)-6-amino-2,2,3,4,5,5-hexadeuteriocyclohex-3-en-1-yl]-7-bromo-2-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-d]pyrimidin-4-amine;2,2,2-trifluoroacetic acid (PubChem CID 175971929) has the molecular formula C19H17BrClF3N4O2S2 and a molecular weight of 575.89 g/mol. Its IUPAC name is 6-[(1S,6S)-6-amino-2,2,3,4,5,5-hexadeuteriocyclohex-3-en-1-yl]-7-bromo-2-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-d]pyrimidin-4-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[(1S,6S)-6-amino-2,2,3,4,5,5-hexadeuteriocyclohex-3-en-1-yl]-7-bromo-2-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-d]pyrimidin-4-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175971929 |
| Molecular Formula | C19H17BrClF3N4O2S2 |
| Molecular Weight | 575.89 g/mol |
| Exact Mass | 574.00 |
| IUPAC Name | 6-[(1S,6S)-6-amino-2,2,3,4,5,5-hexadeuteriocyclohex-3-en-1-yl]-7-bromo-2-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-d]pyrimidin-4-amine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[2H]C1=C([2H])C([2H])([2H])[C@H](c2sc3c(NCc4cccs4)nc(Cl)nc3c2Br)[C@@H](N)C1([2H])[2H] |
| InChI | InChI=1S/C17H16BrClN4S2.C2HF3O2/c18-12-13-15(25-14(12)10-5-1-2-6-11(10)20)16(23-17(19)22-13)21-8-9-4-3-7-24-9;3-2(4,5)1(6)7/h1-4,7,10-11H,5-6,8,20H2,(H,21,22,23);(H,6,7)/t10-,11-;/m0./s1/i1D,2D,5D2,6D2; |
| InChIKey | BZDYXVIBFPNEFM-GQXJEAGVSA-N |
| XLogP | 6.18 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.89 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|