About 2,5-diisocyanato-1,3-dimethylbenzene;isocyanic acid
2,5-diisocyanato-1,3-dimethylbenzene;isocyanic acid (PubChem CID 175972190) has the molecular formula C12H10N4O4
and a molecular weight of 274.24 g/mol. Its IUPAC name is 2,5-diisocyanato-1,3-dimethylbenzene;isocyanic acid.
Molecular Properties
| Compound Name | 2,5-diisocyanato-1,3-dimethylbenzene;isocyanic acid |
| PubChem CID | 175972190 |
| Molecular Formula | C12H10N4O4 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2,5-diisocyanato-1,3-dimethylbenzene;isocyanic acid |
| SMILES | Cc1cc(N=C=O)cc(C)c1N=C=O.N=C=O.N=C=O |
| InChI | InChI=1S/C10H8N2O2.2CHNO/c1-7-3-9(11-5-13)4-8(2)10(7)12-6-14;2*2-1-3/h3-4H,1-2H3;2*2H |
| InChIKey | DZJBQYKKPNWPED-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2,5-diisocyanato-1,3-dimethylbenzene;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diisocyanato-1,3-dimethylbenzene;isocyanic acid?
The IUPAC name of 2,5-diisocyanato-1,3-dimethylbenzene;isocyanic acid (CID 175972190) is 2,5-diisocyanato-1,3-dimethylbenzene;isocyanic acid.
What is the SMILES notation for 2,5-diisocyanato-1,3-dimethylbenzene;isocyanic acid?
The canonical SMILES for 2,5-diisocyanato-1,3-dimethylbenzene;isocyanic acid is Cc1cc(N=C=O)cc(C)c1N=C=O.N=C=O.N=C=O.
What is the InChIKey of 2,5-diisocyanato-1,3-dimethylbenzene;isocyanic acid?
The InChIKey is DZJBQYKKPNWPED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2.2CHNO/c1-7-3-9(11-5-13)4-8(2)10(7)12-6-14;2*2-1-3/h3-4H,1-2H3;2*2H.
What are the key properties of 2,5-diisocyanato-1,3-dimethylbenzene;isocyanic acid?
2,5-diisocyanato-1,3-dimethylbenzene;isocyanic acid has a molecular weight of 274.24 g/mol, XLogP of 2.04, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diisocyanato-1,3-dimethylbenzene;isocyanic acid is sourced from PubChem (CID 175972190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).