About [(1R,3S)-3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] (2R)-2-methylazetidine-1-carboxylate
[(1R,3S)-3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] (2R)-2-methylazetidine-1-carboxylate (PubChem CID 175972510) has the molecular formula C13H20N4O2
and a molecular weight of 264.33 g/mol. Its IUPAC name is [(1R,3S)-3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] (2R)-2-methylazetidine-1-carboxylate.
Molecular Properties
| Compound Name | [(1R,3S)-3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] (2R)-2-methylazetidine-1-carboxylate |
| PubChem CID | 175972510 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | [(1R,3S)-3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] (2R)-2-methylazetidine-1-carboxylate |
| SMILES | C[C@@H]1CCN1C(=O)O[C@@H]1CC[C@H](c2cc(N)n[nH]2)C1 |
| InChI | InChI=1S/C13H20N4O2/c1-8-4-5-17(8)13(18)19-10-3-2-9(6-10)11-7-12(14)16-15-11/h7-10H,2-6H2,1H3,(H3,14,15,16)/t8-,9+,10-/m1/s1 |
| InChIKey | YSKKYGWRMZKQKW-KXUCPTDWSA-N |
| XLogP | 1.86 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R,3S)-3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] (2R)-2-methylazetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,3S)-3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] (2R)-2-methylazetidine-1-carboxylate?
The IUPAC name of [(1R,3S)-3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] (2R)-2-methylazetidine-1-carboxylate (CID 175972510) is [(1R,3S)-3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] (2R)-2-methylazetidine-1-carboxylate.
What is the SMILES notation for [(1R,3S)-3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] (2R)-2-methylazetidine-1-carboxylate?
The canonical SMILES for [(1R,3S)-3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] (2R)-2-methylazetidine-1-carboxylate is C[C@@H]1CCN1C(=O)O[C@@H]1CC[C@H](c2cc(N)n[nH]2)C1.
What is the InChIKey of [(1R,3S)-3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] (2R)-2-methylazetidine-1-carboxylate?
The InChIKey is YSKKYGWRMZKQKW-KXUCPTDWSA-N. The full InChI is InChI=1S/C13H20N4O2/c1-8-4-5-17(8)13(18)19-10-3-2-9(6-10)11-7-12(14)16-15-11/h7-10H,2-6H2,1H3,(H3,14,15,16)/t8-,9+,10-/m1/s1.
What are the key properties of [(1R,3S)-3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] (2R)-2-methylazetidine-1-carboxylate?
[(1R,3S)-3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] (2R)-2-methylazetidine-1-carboxylate has a molecular weight of 264.33 g/mol, XLogP of 1.86, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,3S)-3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] (2R)-2-methylazetidine-1-carboxylate is sourced from PubChem (CID 175972510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).