About (2-fluoro-3-hydroxy-1,3-dimethoxypentyl) 2-ethoxy-2-fluoro-3-hydroxypropanoate
(2-fluoro-3-hydroxy-1,3-dimethoxypentyl) 2-ethoxy-2-fluoro-3-hydroxypropanoate (PubChem CID 175973368) has the molecular formula C12H22F2O7
and a molecular weight of 316.30 g/mol. Its IUPAC name is (2-fluoro-3-hydroxy-1,3-dimethoxypentyl) 2-ethoxy-2-fluoro-3-hydroxypropanoate.
Molecular Properties
| Compound Name | (2-fluoro-3-hydroxy-1,3-dimethoxypentyl) 2-ethoxy-2-fluoro-3-hydroxypropanoate |
| PubChem CID | 175973368 |
| Molecular Formula | C12H22F2O7 |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (2-fluoro-3-hydroxy-1,3-dimethoxypentyl) 2-ethoxy-2-fluoro-3-hydroxypropanoate |
| SMILES | CCOC(F)(CO)C(=O)OC(OC)C(F)C(O)(CC)OC |
| InChI | InChI=1S/C12H22F2O7/c1-5-12(17,19-4)8(13)9(18-3)21-10(16)11(14,7-15)20-6-2/h8-9,15,17H,5-7H2,1-4H3 |
| InChIKey | PZEYKSJUGWGHOX-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2-fluoro-3-hydroxy-1,3-dimethoxypentyl) 2-ethoxy-2-fluoro-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoro-3-hydroxy-1,3-dimethoxypentyl) 2-ethoxy-2-fluoro-3-hydroxypropanoate?
The IUPAC name of (2-fluoro-3-hydroxy-1,3-dimethoxypentyl) 2-ethoxy-2-fluoro-3-hydroxypropanoate (CID 175973368) is (2-fluoro-3-hydroxy-1,3-dimethoxypentyl) 2-ethoxy-2-fluoro-3-hydroxypropanoate.
What is the SMILES notation for (2-fluoro-3-hydroxy-1,3-dimethoxypentyl) 2-ethoxy-2-fluoro-3-hydroxypropanoate?
The canonical SMILES for (2-fluoro-3-hydroxy-1,3-dimethoxypentyl) 2-ethoxy-2-fluoro-3-hydroxypropanoate is CCOC(F)(CO)C(=O)OC(OC)C(F)C(O)(CC)OC.
What is the InChIKey of (2-fluoro-3-hydroxy-1,3-dimethoxypentyl) 2-ethoxy-2-fluoro-3-hydroxypropanoate?
The InChIKey is PZEYKSJUGWGHOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F2O7/c1-5-12(17,19-4)8(13)9(18-3)21-10(16)11(14,7-15)20-6-2/h8-9,15,17H,5-7H2,1-4H3.
What are the key properties of (2-fluoro-3-hydroxy-1,3-dimethoxypentyl) 2-ethoxy-2-fluoro-3-hydroxypropanoate?
(2-fluoro-3-hydroxy-1,3-dimethoxypentyl) 2-ethoxy-2-fluoro-3-hydroxypropanoate has a molecular weight of 316.30 g/mol, XLogP of 0.28, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-3-hydroxy-1,3-dimethoxypentyl) 2-ethoxy-2-fluoro-3-hydroxypropanoate is sourced from PubChem (CID 175973368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).