C33H37NO3 — CID 175973659
tert-butyl 2-[6-(benzhydrylideneamino)-1'-hydroxyspiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-yl]acetate (PubChem CID 175973659) has the molecular formula C33H37NO3 and a molecular weight of 495.66 g/mol. Its IUPAC name is tert-butyl 2-[6-(benzhydrylideneamino)-1'-hydroxyspiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-yl]acetate.
| Compound Name | tert-butyl 2-[6-(benzhydrylideneamino)-1'-hydroxyspiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-yl]acetate |
|---|---|
| PubChem CID | 175973659 |
| Molecular Formula | C33H37NO3 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | tert-butyl 2-[6-(benzhydrylideneamino)-1'-hydroxyspiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1(O)CCC2(CCc3cc(N=C(c4ccccc4)c4ccccc4)ccc32)CC1 |
| InChI | InChI=1S/C33H37NO3/c1-31(2,3)37-29(35)23-33(36)20-18-32(19-21-33)17-16-26-22-27(14-15-28(26)32)34-30(24-10-6-4-7-11-24)25-12-8-5-9-13-25/h4-15,22,36H,16-21,23H2,1-3H3 |
| InChIKey | ZHWINRWTUKGFGP-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|