About chromium(2+);bis(cyclopenta-1,3-dien-1-amine)
chromium(2+);bis(cyclopenta-1,3-dien-1-amine) (PubChem CID 175973663) has the molecular formula C10H12CrN2
and a molecular weight of 212.22 g/mol. Its IUPAC name is chromium(2+);bis(cyclopenta-1,3-dien-1-amine).
Molecular Properties
| Compound Name | chromium(2+);bis(cyclopenta-1,3-dien-1-amine) |
| PubChem CID | 175973663 |
| Molecular Formula | C10H12CrN2 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | chromium(2+);bis(cyclopenta-1,3-dien-1-amine) |
| SMILES | Nc1ccc[cH-]1.Nc1ccc[cH-]1.[Cr+2] |
| InChI | InChI=1S/2C5H6N.Cr/c2*6-5-3-1-2-4-5;/h2*1-4H,6H2;/q2*-1;+2 |
| InChIKey | YGWAYJMWOSGVMI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chromium(2+);bis(cyclopenta-1,3-dien-1-amine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium(2+);bis(cyclopenta-1,3-dien-1-amine)?
The IUPAC name of chromium(2+);bis(cyclopenta-1,3-dien-1-amine) (CID 175973663) is chromium(2+);bis(cyclopenta-1,3-dien-1-amine).
What is the SMILES notation for chromium(2+);bis(cyclopenta-1,3-dien-1-amine)?
The canonical SMILES for chromium(2+);bis(cyclopenta-1,3-dien-1-amine) is Nc1ccc[cH-]1.Nc1ccc[cH-]1.[Cr+2].
What is the InChIKey of chromium(2+);bis(cyclopenta-1,3-dien-1-amine)?
The InChIKey is YGWAYJMWOSGVMI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H6N.Cr/c2*6-5-3-1-2-4-5;/h2*1-4H,6H2;/q2*-1;+2.
What are the key properties of chromium(2+);bis(cyclopenta-1,3-dien-1-amine)?
chromium(2+);bis(cyclopenta-1,3-dien-1-amine) has a molecular weight of 212.22 g/mol, XLogP of 1.97, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromium(2+);bis(cyclopenta-1,3-dien-1-amine) is sourced from PubChem (CID 175973663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).