About cyclooctyloxymethyl 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate
cyclooctyloxymethyl 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 175973733) has the molecular formula C17H24O4
and a molecular weight of 292.38 g/mol. Its IUPAC name is cyclooctyloxymethyl 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate.
Molecular Properties
| Compound Name | cyclooctyloxymethyl 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate |
| PubChem CID | 175973733 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | cyclooctyloxymethyl 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C1C2C=CC1C(C(=O)OCOC1CCCCCCC1)C2 |
| InChI | InChI=1S/C17H24O4/c18-16-12-8-9-14(16)15(10-12)17(19)21-11-20-13-6-4-2-1-3-5-7-13/h8-9,12-15H,1-7,10-11H2 |
| InChIKey | GYZBWELSQRQWIJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclooctyloxymethyl 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclooctyloxymethyl 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate?
The IUPAC name of cyclooctyloxymethyl 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate (CID 175973733) is cyclooctyloxymethyl 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate.
What is the SMILES notation for cyclooctyloxymethyl 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate?
The canonical SMILES for cyclooctyloxymethyl 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate is O=C1C2C=CC1C(C(=O)OCOC1CCCCCCC1)C2.
What is the InChIKey of cyclooctyloxymethyl 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate?
The InChIKey is GYZBWELSQRQWIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O4/c18-16-12-8-9-14(16)15(10-12)17(19)21-11-20-13-6-4-2-1-3-5-7-13/h8-9,12-15H,1-7,10-11H2.
What are the key properties of cyclooctyloxymethyl 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate?
cyclooctyloxymethyl 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate has a molecular weight of 292.38 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclooctyloxymethyl 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate is sourced from PubChem (CID 175973733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).