C24H26FN7O3 — CID 175973858
2-fluoro-N-[5-(3,3,3-trideuteriopropanoyl)-4-[[(4R)-2,4,5-trimethyl-1-oxo-4H-[1,2,4]triazolo[4,3-a]quinoxalin-6-yl]amino]-2-pyridinyl]cyclopropane-1-carboxamide (PubChem CID 175973858) has the molecular formula C24H26FN7O3 and a molecular weight of 482.53 g/mol. Its IUPAC name is 2-fluoro-N-[5-(3,3,3-trideuteriopropanoyl)-4-[[(4R)-2,4,5-trimethyl-1-oxo-4H-[1,2,4]triazolo[4,3-a]quinoxalin-6-yl]amino]-2-pyridinyl]cyclopropane-1-carboxamide.
| Compound Name | 2-fluoro-N-[5-(3,3,3-trideuteriopropanoyl)-4-[[(4R)-2,4,5-trimethyl-1-oxo-4H-[1,2,4]triazolo[4,3-a]quinoxalin-6-yl]amino]-2-pyridinyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 175973858 |
| Molecular Formula | C24H26FN7O3 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 2-fluoro-N-[5-(3,3,3-trideuteriopropanoyl)-4-[[(4R)-2,4,5-trimethyl-1-oxo-4H-[1,2,4]triazolo[4,3-a]quinoxalin-6-yl]amino]-2-pyridinyl]cyclopropane-1-carboxamide |
| SMILES | [2H]C([2H])([2H])CC(=O)c1cnc(NC(=O)C2CC2F)cc1Nc1cccc2c1N(C)[C@H](C)c1nn(C)c(=O)n1-2 |
| InChI | InChI=1S/C24H26FN7O3/c1-5-19(33)14-11-26-20(28-23(34)13-9-15(13)25)10-17(14)27-16-7-6-8-18-21(16)30(3)12(2)22-29-31(4)24(35)32(18)22/h6-8,10-13,15H,5,9H2,1-4H3,(H2,26,27,28,34)/t12-,13?,15?/m1/s1/i1D3 |
| InChIKey | ZCGSRYMEYSXVHZ-VOTWBOPVSA-N |
| XLogP | 3.11 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |