C24H26AsN6O2 — CID 175973878
CID 175973878 (PubChem CID 175973878) has the molecular formula C24H26AsN6O2 and a molecular weight of 508.45 g/mol.
| Compound Name | CID 175973878 |
|---|---|
| PubChem CID | 175973878 |
| Molecular Formula | C24H26AsN6O2 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])CC(=O)c1cnc(NC(=O)C2CC2)cc1[As]c1cccc2c1N(CC)Cc1nn(C)nc1-2 |
| InChI | InChI=1S/C24H26AsN6O2/c1-4-20(32)16-12-26-21(27-24(33)14-9-10-14)11-18(16)25-17-8-6-7-15-22-19(28-30(3)29-22)13-31(5-2)23(15)17/h6-8,11-12,14H,4-5,9-10,13H2,1-3H3,(H,26,27,33)/i1D3 |
| InChIKey | IUJPTUZHSJPILZ-FIBGUPNXSA-N |
| XLogP | 1.81 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|