C15H21FN4O6S2 — CID 175973950
2-fluoro-4-[2-hydroxy-6-[[[(3S)-1-methylsulfonylpiperidin-3-yl]amino]methyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 175973950) has the molecular formula C15H21FN4O6S2 and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-fluoro-4-[2-hydroxy-6-[[[(3S)-1-methylsulfonylpiperidin-3-yl]amino]methyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 2-fluoro-4-[2-hydroxy-6-[[[(3S)-1-methylsulfonylpiperidin-3-yl]amino]methyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 175973950 |
| Molecular Formula | C15H21FN4O6S2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 2-fluoro-4-[2-hydroxy-6-[[[(3S)-1-methylsulfonylpiperidin-3-yl]amino]methyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | CS(=O)(=O)N1CCC[C@H](NCc2cccc(O)c2C2NS(=O)(=O)N(F)C2=O)C1 |
| InChI | InChI=1S/C15H21FN4O6S2/c1-27(23,24)19-7-3-5-11(9-19)17-8-10-4-2-6-12(21)13(10)14-15(22)20(16)28(25,26)18-14/h2,4,6,11,14,17-18,21H,3,5,7-9H2,1H3/t11-,14?/m0/s1 |
| InChIKey | WFMDJWOSVGSORT-ZSOXZCCMSA-N |
| XLogP | -0.49 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|