C19H18F2N6O2 — CID 175976654
1-[3-[4-amino-2-(2-methyl-1,3-oxazol-5-yl)imidazo[2,1-f][1,2,4]triazin-7-yl]-4-methylphenyl]-1,1-difluoropropan-2-ol (PubChem CID 175976654) has the molecular formula C19H18F2N6O2 and a molecular weight of 400.39 g/mol. Its IUPAC name is 1-[3-[4-amino-2-(2-methyl-1,3-oxazol-5-yl)imidazo[2,1-f][1,2,4]triazin-7-yl]-4-methylphenyl]-1,1-difluoropropan-2-ol.
| Compound Name | 1-[3-[4-amino-2-(2-methyl-1,3-oxazol-5-yl)imidazo[2,1-f][1,2,4]triazin-7-yl]-4-methylphenyl]-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 175976654 |
| Molecular Formula | C19H18F2N6O2 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-[3-[4-amino-2-(2-methyl-1,3-oxazol-5-yl)imidazo[2,1-f][1,2,4]triazin-7-yl]-4-methylphenyl]-1,1-difluoropropan-2-ol |
| SMILES | Cc1ncc(-c2nc(N)c3ncc(-c4cc(C(F)(F)C(C)O)ccc4C)n3n2)o1 |
| InChI | InChI=1S/C19H18F2N6O2/c1-9-4-5-12(19(20,21)10(2)28)6-13(9)14-7-24-18-16(22)25-17(26-27(14)18)15-8-23-11(3)29-15/h4-8,10,28H,1-3H3,(H2,22,25,26) |
| InChIKey | ZYYYSELQBWBOSQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |