C11H16N4O2 — CID 175977799
(7E)-7-hydroxyimino-N,N,1-trimethyl-5,6-dihydro-4H-indazole-3-carboxamide (PubChem CID 175977799) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is (7E)-7-hydroxyimino-N,N,1-trimethyl-5,6-dihydro-4H-indazole-3-carboxamide.
| Compound Name | (7E)-7-hydroxyimino-N,N,1-trimethyl-5,6-dihydro-4H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 175977799 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (7E)-7-hydroxyimino-N,N,1-trimethyl-5,6-dihydro-4H-indazole-3-carboxamide |
| SMILES | CN(C)C(=O)c1nn(C)c2c1CCC/C2=N\O |
| InChI | InChI=1S/C11H16N4O2/c1-14(2)11(16)9-7-5-4-6-8(13-17)10(7)15(3)12-9/h17H,4-6H2,1-3H3/b13-8+ |
| InChIKey | LYDGIBSSMUMPJE-MDWZMJQESA-N |
| XLogP | 0.64 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|