About 2-deuteriopurine-2,6-diamine
2-deuteriopurine-2,6-diamine (PubChem CID 175978907) has the molecular formula C5H6N6
and a molecular weight of 151.15 g/mol. Its IUPAC name is 2-deuteriopurine-2,6-diamine.
Molecular Properties
| Compound Name | 2-deuteriopurine-2,6-diamine |
| PubChem CID | 175978907 |
| Molecular Formula | C5H6N6 |
| Molecular Weight | 151.15 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | 2-deuteriopurine-2,6-diamine |
| SMILES | [2H]C1(N)N=C(N)C2=NC=NC2=N1 |
| InChI | InChI=1S/C5H6N6/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1,5H,7H2,(H2,6,10)/i5D |
| InChIKey | KGPMNVHJVDETJJ-UICOGKGYSA-N |
| XLogP | -1.52 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.15 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-deuteriopurine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-deuteriopurine-2,6-diamine?
The IUPAC name of 2-deuteriopurine-2,6-diamine (CID 175978907) is 2-deuteriopurine-2,6-diamine.
What is the SMILES notation for 2-deuteriopurine-2,6-diamine?
The canonical SMILES for 2-deuteriopurine-2,6-diamine is [2H]C1(N)N=C(N)C2=NC=NC2=N1.
What is the InChIKey of 2-deuteriopurine-2,6-diamine?
The InChIKey is KGPMNVHJVDETJJ-UICOGKGYSA-N. The full InChI is InChI=1S/C5H6N6/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1,5H,7H2,(H2,6,10)/i5D.
What are the key properties of 2-deuteriopurine-2,6-diamine?
2-deuteriopurine-2,6-diamine has a molecular weight of 151.15 g/mol, XLogP of -1.52, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuteriopurine-2,6-diamine is sourced from PubChem (CID 175978907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).