C32H47BrN4O5S — CID 175979569
(2S,4S)-1-[(2S)-2-(10-bromodecanoylamino)-3,3-dimethylbutanoyl]-4-hydroxy-N-[[4-(4-methylsulfanyl-1,3-oxazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 175979569) has the molecular formula C32H47BrN4O5S and a molecular weight of 679.72 g/mol. Its IUPAC name is (2S,4S)-1-[(2S)-2-(10-bromodecanoylamino)-3,3-dimethylbutanoyl]-4-hydroxy-N-[[4-(4-methylsulfanyl-1,3-oxazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[(2S)-2-(10-bromodecanoylamino)-3,3-dimethylbutanoyl]-4-hydroxy-N-[[4-(4-methylsulfanyl-1,3-oxazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 175979569 |
| Molecular Formula | C32H47BrN4O5S |
| Molecular Weight | 679.72 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | (2S,4S)-1-[(2S)-2-(10-bromodecanoylamino)-3,3-dimethylbutanoyl]-4-hydroxy-N-[[4-(4-methylsulfanyl-1,3-oxazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CSc1ncoc1-c1ccc(CNC(=O)[C@@H]2C[C@H](O)CN2C(=O)[C@@H](NC(=O)CCCCCCCCCBr)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H47BrN4O5S/c1-32(2,3)28(36-26(39)12-10-8-6-5-7-9-11-17-33)31(41)37-20-24(38)18-25(37)29(40)34-19-22-13-15-23(16-14-22)27-30(43-4)35-21-42-27/h13-16,21,24-25,28,38H,5-12,17-20H2,1-4H3,(H,34,40)(H,36,39)/t24-,25-,28+/m0/s1 |
| InChIKey | YZKSYQBNWJOXJS-PNIUZAESSA-N |
| XLogP | 5.69 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.72 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|