C25H49NO5 — CID 175979651
2-[6-[decyl(3-hydroxypropyl)amino]hexyl]-2-propylpropanedioic acid (PubChem CID 175979651) has the molecular formula C25H49NO5 and a molecular weight of 443.67 g/mol. Its IUPAC name is 2-[6-[decyl(3-hydroxypropyl)amino]hexyl]-2-propylpropanedioic acid.
| Compound Name | 2-[6-[decyl(3-hydroxypropyl)amino]hexyl]-2-propylpropanedioic acid |
|---|---|
| PubChem CID | 175979651 |
| Molecular Formula | C25H49NO5 |
| Molecular Weight | 443.67 g/mol |
| Exact Mass | 443.36 |
| IUPAC Name | 2-[6-[decyl(3-hydroxypropyl)amino]hexyl]-2-propylpropanedioic acid |
| SMILES | CCCCCCCCCCN(CCCO)CCCCCCC(CCC)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C25H49NO5/c1-3-5-6-7-8-9-11-14-19-26(21-16-22-27)20-15-12-10-13-18-25(17-4-2,23(28)29)24(30)31/h27H,3-22H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | NMDCZKATPPLHDG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.67 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|