C17H8F7NO — CID 175979724
2,2,7-trifluoro-4-prop-2-ynyl-6-(2,3,4,5-tetrafluorophenyl)-3H-1,4-benzoxazine (PubChem CID 175979724) has the molecular formula C17H8F7NO and a molecular weight of 375.24 g/mol. Its IUPAC name is 2,2,7-trifluoro-4-prop-2-ynyl-6-(2,3,4,5-tetrafluorophenyl)-3H-1,4-benzoxazine.
| Compound Name | 2,2,7-trifluoro-4-prop-2-ynyl-6-(2,3,4,5-tetrafluorophenyl)-3H-1,4-benzoxazine |
|---|---|
| PubChem CID | 175979724 |
| Molecular Formula | C17H8F7NO |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 2,2,7-trifluoro-4-prop-2-ynyl-6-(2,3,4,5-tetrafluorophenyl)-3H-1,4-benzoxazine |
| SMILES | C#CCN1CC(F)(F)Oc2cc(F)c(-c3cc(F)c(F)c(F)c3F)cc21 |
| InChI | InChI=1S/C17H8F7NO/c1-2-3-25-7-17(23,24)26-13-6-10(18)8(5-12(13)25)9-4-11(19)15(21)16(22)14(9)20/h1,4-6H,3,7H2 |
| InChIKey | ODPNSRTWAMNGGD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|