C14H26N4OS2 — CID 175979938
(2S)-N-[(4S,7S,9aS)-7-amino-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)propanethioamide (PubChem CID 175979938) has the molecular formula C14H26N4OS2 and a molecular weight of 330.52 g/mol. Its IUPAC name is (2S)-N-[(4S,7S,9aS)-7-amino-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)propanethioamide.
| Compound Name | (2S)-N-[(4S,7S,9aS)-7-amino-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)propanethioamide |
|---|---|
| PubChem CID | 175979938 |
| Molecular Formula | C14H26N4OS2 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (2S)-N-[(4S,7S,9aS)-7-amino-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl]-2-(methylamino)propanethioamide |
| SMILES | CN[C@@H](C)C(=S)N[C@H]1CCS[C@H]2CC(C)(C)[C@@H](N)N2C1=O |
| InChI | InChI=1S/C14H26N4OS2/c1-8(16-4)11(20)17-9-5-6-21-10-7-14(2,3)13(15)18(10)12(9)19/h8-10,13,16H,5-7,15H2,1-4H3,(H,17,20)/t8-,9-,10-,13-/m0/s1 |
| InChIKey | LENBLWASMQSXCA-YVNDNENWSA-N |
| XLogP | 0.89 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|