About 3-fluoro-2H-chromen-4-ol
3-fluoro-2H-chromen-4-ol (PubChem CID 175979949) has the molecular formula C9H7FO2
and a molecular weight of 166.15 g/mol. Its IUPAC name is 3-fluoro-2H-chromen-4-ol.
Molecular Properties
| Compound Name | 3-fluoro-2H-chromen-4-ol |
| PubChem CID | 175979949 |
| Molecular Formula | C9H7FO2 |
| Molecular Weight | 166.15 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | 3-fluoro-2H-chromen-4-ol |
| SMILES | OC1=C(F)COc2ccccc21 |
| InChI | InChI=1S/C9H7FO2/c10-7-5-12-8-4-2-1-3-6(8)9(7)11/h1-4,11H,5H2 |
| InChIKey | SQZLLGZSBVZZMD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.15 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-2H-chromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2H-chromen-4-ol?
The IUPAC name of 3-fluoro-2H-chromen-4-ol (CID 175979949) is 3-fluoro-2H-chromen-4-ol.
What is the SMILES notation for 3-fluoro-2H-chromen-4-ol?
The canonical SMILES for 3-fluoro-2H-chromen-4-ol is OC1=C(F)COc2ccccc21.
What is the InChIKey of 3-fluoro-2H-chromen-4-ol?
The InChIKey is SQZLLGZSBVZZMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FO2/c10-7-5-12-8-4-2-1-3-6(8)9(7)11/h1-4,11H,5H2.
What are the key properties of 3-fluoro-2H-chromen-4-ol?
3-fluoro-2H-chromen-4-ol has a molecular weight of 166.15 g/mol, XLogP of 2.28, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2H-chromen-4-ol is sourced from PubChem (CID 175979949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).