C9H9F10LiO2 — CID 175979990
lithium 4-(1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-yloxy)butan-2-olate (PubChem CID 175979990) has the molecular formula C9H9F10LiO2 and a molecular weight of 346.09 g/mol. Its IUPAC name is lithium 4-(1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-yloxy)butan-2-olate.
| Compound Name | lithium 4-(1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-yloxy)butan-2-olate |
|---|---|
| PubChem CID | 175979990 |
| Molecular Formula | C9H9F10LiO2 |
| Molecular Weight | 346.09 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | lithium 4-(1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-yloxy)butan-2-olate |
| SMILES | CC([O-])CCOC(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F.[Li+] |
| InChI | InChI=1S/C9H9F10O2.Li/c1-4(20)2-3-21-5(6(10,11)8(14,15)16)7(12,13)9(17,18)19;/h4-5H,2-3H2,1H3;/q-1;+1 |
| InChIKey | BVLQKFPTOJRIIX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.09 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|