C9H14F6O3 — CID 175980000
1,5-bis(2,2,2-trifluoroethoxy)pentan-3-ol (PubChem CID 175980000) has the molecular formula C9H14F6O3 and a molecular weight of 284.20 g/mol. Its IUPAC name is 1,5-bis(2,2,2-trifluoroethoxy)pentan-3-ol.
| Compound Name | 1,5-bis(2,2,2-trifluoroethoxy)pentan-3-ol |
|---|---|
| PubChem CID | 175980000 |
| Molecular Formula | C9H14F6O3 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1,5-bis(2,2,2-trifluoroethoxy)pentan-3-ol |
| SMILES | OC(CCOCC(F)(F)F)CCOCC(F)(F)F |
| InChI | InChI=1S/C9H14F6O3/c10-8(11,12)5-17-3-1-7(16)2-4-18-6-9(13,14)15/h7,16H,1-6H2 |
| InChIKey | PPZDXRICFGIPHM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|