C7H6F9LiO2 — CID 175980018
lithium 3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxypropan-1-olate (PubChem CID 175980018) has the molecular formula C7H6F9LiO2 and a molecular weight of 300.05 g/mol. Its IUPAC name is lithium 3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxypropan-1-olate.
| Compound Name | lithium 3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxypropan-1-olate |
|---|---|
| PubChem CID | 175980018 |
| Molecular Formula | C7H6F9LiO2 |
| Molecular Weight | 300.05 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | lithium 3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxypropan-1-olate |
| SMILES | [Li+].[O-]CCCOC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F9O2.Li/c8-5(9,10)4(6(11,12)13,7(14,15)16)18-3-1-2-17;/h1-3H2;/q-1;+1 |
| InChIKey | DERFWQCGTFUABK-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.05 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|