C52H76N4O10 — CID 175980947
tert-butyl (3aS,6aR)-5-[oxan-4-ylmethyl(phenylmethoxycarbonyl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 175980947) has the molecular formula C52H76N4O10 and a molecular weight of 917.20 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-5-[oxan-4-ylmethyl(phenylmethoxycarbonyl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-5-[oxan-4-ylmethyl(phenylmethoxycarbonyl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 175980947 |
| Molecular Formula | C52H76N4O10 |
| Molecular Weight | 917.20 g/mol |
| Exact Mass | 916.56 |
| IUPAC Name | tert-butyl (3aS,6aR)-5-[oxan-4-ylmethyl(phenylmethoxycarbonyl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC(N(CC3CCOCC3)C(=O)OCc3ccccc3)C[C@H]2C1.CC(C)(C)OC(=O)N1C[C@H]2CC(N(CC3CCOCC3)C(=O)OCc3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/2C26H38N2O5/c2*1-26(2,3)33-24(29)27-16-21-13-23(14-22(21)17-27)28(15-19-9-11-31-12-10-19)25(30)32-18-20-7-5-4-6-8-20/h2*4-8,19,21-23H,9-18H2,1-3H3/t2*21-,22+,23? |
| InChIKey | WWRGEUVEMGTVSW-LZOCULQKSA-N |
| XLogP | 9.39 |
| TPSA | 136.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.20 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|