About 4-(4-bromo-3-fluorophenyl)-2,3-dihydrochromen-4-ol
4-(4-bromo-3-fluorophenyl)-2,3-dihydrochromen-4-ol (PubChem CID 175981158) has the molecular formula C15H12BrFO2
and a molecular weight of 323.16 g/mol. Its IUPAC name is 4-(4-bromo-3-fluorophenyl)-2,3-dihydrochromen-4-ol.
Molecular Properties
| Compound Name | 4-(4-bromo-3-fluorophenyl)-2,3-dihydrochromen-4-ol |
| PubChem CID | 175981158 |
| Molecular Formula | C15H12BrFO2 |
| Molecular Weight | 323.16 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 4-(4-bromo-3-fluorophenyl)-2,3-dihydrochromen-4-ol |
| SMILES | OC1(c2ccc(Br)c(F)c2)CCOc2ccccc21 |
| InChI | InChI=1S/C15H12BrFO2/c16-12-6-5-10(9-13(12)17)15(18)7-8-19-14-4-2-1-3-11(14)15/h1-6,9,18H,7-8H2 |
| InChIKey | HNEHSPDGVPRCBW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.16 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-bromo-3-fluorophenyl)-2,3-dihydrochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromo-3-fluorophenyl)-2,3-dihydrochromen-4-ol?
The IUPAC name of 4-(4-bromo-3-fluorophenyl)-2,3-dihydrochromen-4-ol (CID 175981158) is 4-(4-bromo-3-fluorophenyl)-2,3-dihydrochromen-4-ol.
What is the SMILES notation for 4-(4-bromo-3-fluorophenyl)-2,3-dihydrochromen-4-ol?
The canonical SMILES for 4-(4-bromo-3-fluorophenyl)-2,3-dihydrochromen-4-ol is OC1(c2ccc(Br)c(F)c2)CCOc2ccccc21.
What is the InChIKey of 4-(4-bromo-3-fluorophenyl)-2,3-dihydrochromen-4-ol?
The InChIKey is HNEHSPDGVPRCBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrFO2/c16-12-6-5-10(9-13(12)17)15(18)7-8-19-14-4-2-1-3-11(14)15/h1-6,9,18H,7-8H2.
What are the key properties of 4-(4-bromo-3-fluorophenyl)-2,3-dihydrochromen-4-ol?
4-(4-bromo-3-fluorophenyl)-2,3-dihydrochromen-4-ol has a molecular weight of 323.16 g/mol, XLogP of 3.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromo-3-fluorophenyl)-2,3-dihydrochromen-4-ol is sourced from PubChem (CID 175981158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).