About 3-[3-(2,2-dimethyl-3-oxopropyl)imidazolidin-1-yl]-2,2-dimethylpropanal
3-[3-(2,2-dimethyl-3-oxopropyl)imidazolidin-1-yl]-2,2-dimethylpropanal (PubChem CID 175981178) has the molecular formula C13H24N2O2
and a molecular weight of 240.35 g/mol. Its IUPAC name is 3-[3-(2,2-dimethyl-3-oxopropyl)imidazolidin-1-yl]-2,2-dimethylpropanal.
Molecular Properties
| Compound Name | 3-[3-(2,2-dimethyl-3-oxopropyl)imidazolidin-1-yl]-2,2-dimethylpropanal |
| PubChem CID | 175981178 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 3-[3-(2,2-dimethyl-3-oxopropyl)imidazolidin-1-yl]-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)CN1CCN(CC(C)(C)C=O)C1 |
| InChI | InChI=1S/C13H24N2O2/c1-12(2,9-16)7-14-5-6-15(11-14)8-13(3,4)10-17/h9-10H,5-8,11H2,1-4H3 |
| InChIKey | VWSNAYFZYBEGAB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(2,2-dimethyl-3-oxopropyl)imidazolidin-1-yl]-2,2-dimethylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2,2-dimethyl-3-oxopropyl)imidazolidin-1-yl]-2,2-dimethylpropanal?
The IUPAC name of 3-[3-(2,2-dimethyl-3-oxopropyl)imidazolidin-1-yl]-2,2-dimethylpropanal (CID 175981178) is 3-[3-(2,2-dimethyl-3-oxopropyl)imidazolidin-1-yl]-2,2-dimethylpropanal.
What is the SMILES notation for 3-[3-(2,2-dimethyl-3-oxopropyl)imidazolidin-1-yl]-2,2-dimethylpropanal?
The canonical SMILES for 3-[3-(2,2-dimethyl-3-oxopropyl)imidazolidin-1-yl]-2,2-dimethylpropanal is CC(C)(C=O)CN1CCN(CC(C)(C)C=O)C1.
What is the InChIKey of 3-[3-(2,2-dimethyl-3-oxopropyl)imidazolidin-1-yl]-2,2-dimethylpropanal?
The InChIKey is VWSNAYFZYBEGAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O2/c1-12(2,9-16)7-14-5-6-15(11-14)8-13(3,4)10-17/h9-10H,5-8,11H2,1-4H3.
What are the key properties of 3-[3-(2,2-dimethyl-3-oxopropyl)imidazolidin-1-yl]-2,2-dimethylpropanal?
3-[3-(2,2-dimethyl-3-oxopropyl)imidazolidin-1-yl]-2,2-dimethylpropanal has a molecular weight of 240.35 g/mol, XLogP of 1.01, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2,2-dimethyl-3-oxopropyl)imidazolidin-1-yl]-2,2-dimethylpropanal is sourced from PubChem (CID 175981178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).