C17H29O3P — CID 175982044
5-(3,5-dimethylphenyl)nonan-5-ylphosphonic acid (PubChem CID 175982044) has the molecular formula C17H29O3P and a molecular weight of 312.39 g/mol. Its IUPAC name is 5-(3,5-dimethylphenyl)nonan-5-ylphosphonic acid.
| Compound Name | 5-(3,5-dimethylphenyl)nonan-5-ylphosphonic acid |
|---|---|
| PubChem CID | 175982044 |
| Molecular Formula | C17H29O3P |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 5-(3,5-dimethylphenyl)nonan-5-ylphosphonic acid |
| SMILES | CCCCC(CCCC)(c1cc(C)cc(C)c1)P(=O)(O)O |
| InChI | InChI=1S/C17H29O3P/c1-5-7-9-17(10-8-6-2,21(18,19)20)16-12-14(3)11-15(4)13-16/h11-13H,5-10H2,1-4H3,(H2,18,19,20) |
| InChIKey | VOQZKVRMMLIDFN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|