About 1-[[2,6-dimethyl-4-(1-phenylazetidin-3-yl)phenyl]methyl]-3-methylazetidin-3-ol;formic acid
1-[[2,6-dimethyl-4-(1-phenylazetidin-3-yl)phenyl]methyl]-3-methylazetidin-3-ol;formic acid (PubChem CID 175982091) has the molecular formula C23H30N2O3
and a molecular weight of 382.50 g/mol. Its IUPAC name is 1-[[2,6-dimethyl-4-(1-phenylazetidin-3-yl)phenyl]methyl]-3-methylazetidin-3-ol;formic acid.
Molecular Properties
| Compound Name | 1-[[2,6-dimethyl-4-(1-phenylazetidin-3-yl)phenyl]methyl]-3-methylazetidin-3-ol;formic acid |
| PubChem CID | 175982091 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 1-[[2,6-dimethyl-4-(1-phenylazetidin-3-yl)phenyl]methyl]-3-methylazetidin-3-ol;formic acid |
| SMILES | Cc1cc(C2CN(c3ccccc3)C2)cc(C)c1CN1CC(C)(O)C1.O=CO |
| InChI | InChI=1S/C22H28N2O.CH2O2/c1-16-9-18(19-11-24(12-19)20-7-5-4-6-8-20)10-17(2)21(16)13-23-14-22(3,25)15-23;2-1-3/h4-10,19,25H,11-15H2,1-3H3;1H,(H,2,3) |
| InChIKey | ADJKFRAPGNPWDQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2,6-dimethyl-4-(1-phenylazetidin-3-yl)phenyl]methyl]-3-methylazetidin-3-ol;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2,6-dimethyl-4-(1-phenylazetidin-3-yl)phenyl]methyl]-3-methylazetidin-3-ol;formic acid?
The IUPAC name of 1-[[2,6-dimethyl-4-(1-phenylazetidin-3-yl)phenyl]methyl]-3-methylazetidin-3-ol;formic acid (CID 175982091) is 1-[[2,6-dimethyl-4-(1-phenylazetidin-3-yl)phenyl]methyl]-3-methylazetidin-3-ol;formic acid.
What is the SMILES notation for 1-[[2,6-dimethyl-4-(1-phenylazetidin-3-yl)phenyl]methyl]-3-methylazetidin-3-ol;formic acid?
The canonical SMILES for 1-[[2,6-dimethyl-4-(1-phenylazetidin-3-yl)phenyl]methyl]-3-methylazetidin-3-ol;formic acid is Cc1cc(C2CN(c3ccccc3)C2)cc(C)c1CN1CC(C)(O)C1.O=CO.
What is the InChIKey of 1-[[2,6-dimethyl-4-(1-phenylazetidin-3-yl)phenyl]methyl]-3-methylazetidin-3-ol;formic acid?
The InChIKey is ADJKFRAPGNPWDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O.CH2O2/c1-16-9-18(19-11-24(12-19)20-7-5-4-6-8-20)10-17(2)21(16)13-23-14-22(3,25)15-23;2-1-3/h4-10,19,25H,11-15H2,1-3H3;1H,(H,2,3).
What are the key properties of 1-[[2,6-dimethyl-4-(1-phenylazetidin-3-yl)phenyl]methyl]-3-methylazetidin-3-ol;formic acid?
1-[[2,6-dimethyl-4-(1-phenylazetidin-3-yl)phenyl]methyl]-3-methylazetidin-3-ol;formic acid has a molecular weight of 382.50 g/mol, XLogP of 3.17, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2,6-dimethyl-4-(1-phenylazetidin-3-yl)phenyl]methyl]-3-methylazetidin-3-ol;formic acid is sourced from PubChem (CID 175982091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).