C45H86O9 — CID 175983049
6-O-[2-(4,4-dioctoxybutanoyloxymethyl)-3-hydroxypropyl] 1-O-(3-hexylnonyl) hexanedioate (PubChem CID 175983049) has the molecular formula C45H86O9 and a molecular weight of 771.17 g/mol. Its IUPAC name is 6-O-[2-(4,4-dioctoxybutanoyloxymethyl)-3-hydroxypropyl] 1-O-(3-hexylnonyl) hexanedioate.
| Compound Name | 6-O-[2-(4,4-dioctoxybutanoyloxymethyl)-3-hydroxypropyl] 1-O-(3-hexylnonyl) hexanedioate |
|---|---|
| PubChem CID | 175983049 |
| Molecular Formula | C45H86O9 |
| Molecular Weight | 771.17 g/mol |
| Exact Mass | 770.63 |
| IUPAC Name | 6-O-[2-(4,4-dioctoxybutanoyloxymethyl)-3-hydroxypropyl] 1-O-(3-hexylnonyl) hexanedioate |
| SMILES | CCCCCCCCOC(CCC(=O)OCC(CO)COC(=O)CCCCC(=O)OCCC(CCCCCC)CCCCCC)OCCCCCCCC |
| InChI | InChI=1S/C45H86O9/c1-5-9-13-17-19-25-34-51-45(52-35-26-20-18-14-10-6-2)32-31-44(49)54-39-41(37-46)38-53-43(48)30-24-23-29-42(47)50-36-33-40(27-21-15-11-7-3)28-22-16-12-8-4/h40-41,45-46H,5-39H2,1-4H3 |
| InChIKey | VXEFVEJASZLWRF-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.17 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|