About 3-(7,10-dioxadispiro[2.2.46.23]dodecan-12-ylmethyl)benzimidazole-5-carbonitrile;iron
3-(7,10-dioxadispiro[2.2.46.23]dodecan-12-ylmethyl)benzimidazole-5-carbonitrile;iron (PubChem CID 175983318) has the molecular formula C19H21FeN3O2
and a molecular weight of 379.24 g/mol. Its IUPAC name is 3-(7,10-dioxadispiro[2.2.46.23]dodecan-12-ylmethyl)benzimidazole-5-carbonitrile;iron.
Molecular Properties
| Compound Name | 3-(7,10-dioxadispiro[2.2.46.23]dodecan-12-ylmethyl)benzimidazole-5-carbonitrile;iron |
| PubChem CID | 175983318 |
| Molecular Formula | C19H21FeN3O2 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 3-(7,10-dioxadispiro[2.2.46.23]dodecan-12-ylmethyl)benzimidazole-5-carbonitrile;iron |
| SMILES | N#Cc1ccc2ncn(CC3CC4(CCC35CC5)OCCO4)c2c1.[Fe] |
| InChI | InChI=1S/C19H21N3O2.Fe/c20-11-14-1-2-16-17(9-14)22(13-21-16)12-15-10-19(23-7-8-24-19)6-5-18(15)3-4-18;/h1-2,9,13,15H,3-8,10,12H2; |
| InChIKey | GETIRHMWEOMOHN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(7,10-dioxadispiro[2.2.46.23]dodecan-12-ylmethyl)benzimidazole-5-carbonitrile;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(7,10-dioxadispiro[2.2.46.23]dodecan-12-ylmethyl)benzimidazole-5-carbonitrile;iron?
The IUPAC name of 3-(7,10-dioxadispiro[2.2.46.23]dodecan-12-ylmethyl)benzimidazole-5-carbonitrile;iron (CID 175983318) is 3-(7,10-dioxadispiro[2.2.46.23]dodecan-12-ylmethyl)benzimidazole-5-carbonitrile;iron.
What is the SMILES notation for 3-(7,10-dioxadispiro[2.2.46.23]dodecan-12-ylmethyl)benzimidazole-5-carbonitrile;iron?
The canonical SMILES for 3-(7,10-dioxadispiro[2.2.46.23]dodecan-12-ylmethyl)benzimidazole-5-carbonitrile;iron is N#Cc1ccc2ncn(CC3CC4(CCC35CC5)OCCO4)c2c1.[Fe].
What is the InChIKey of 3-(7,10-dioxadispiro[2.2.46.23]dodecan-12-ylmethyl)benzimidazole-5-carbonitrile;iron?
The InChIKey is GETIRHMWEOMOHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O2.Fe/c20-11-14-1-2-16-17(9-14)22(13-21-16)12-15-10-19(23-7-8-24-19)6-5-18(15)3-4-18;/h1-2,9,13,15H,3-8,10,12H2;.
What are the key properties of 3-(7,10-dioxadispiro[2.2.46.23]dodecan-12-ylmethyl)benzimidazole-5-carbonitrile;iron?
3-(7,10-dioxadispiro[2.2.46.23]dodecan-12-ylmethyl)benzimidazole-5-carbonitrile;iron has a molecular weight of 379.24 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7,10-dioxadispiro[2.2.46.23]dodecan-12-ylmethyl)benzimidazole-5-carbonitrile;iron is sourced from PubChem (CID 175983318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).