C17H11NO — CID 175983343
6-deuterio-2-naphthalen-2-yl-1,3-benzoxazole (PubChem CID 175983343) has the molecular formula C17H11NO and a molecular weight of 246.29 g/mol. Its IUPAC name is 6-deuterio-2-naphthalen-2-yl-1,3-benzoxazole.
| Compound Name | 6-deuterio-2-naphthalen-2-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 175983343 |
| Molecular Formula | C17H11NO |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 6-deuterio-2-naphthalen-2-yl-1,3-benzoxazole |
| SMILES | [2H]c1ccc2nc(-c3ccc4ccccc4c3)oc2c1 |
| InChI | InChI=1S/C17H11NO/c1-2-6-13-11-14(10-9-12(13)5-1)17-18-15-7-3-4-8-16(15)19-17/h1-11H/i4D |
| InChIKey | XTFVRSDPQJOAQJ-QYKNYGDISA-N |
| XLogP | 4.65 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |