About formic acid;piperidine-2,6-dione
formic acid;piperidine-2,6-dione (PubChem CID 175983353) has the molecular formula C7H11NO6
and a molecular weight of 205.17 g/mol. Its IUPAC name is formic acid;piperidine-2,6-dione.
Molecular Properties
| Compound Name | formic acid;piperidine-2,6-dione |
| PubChem CID | 175983353 |
| Molecular Formula | C7H11NO6 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | formic acid;piperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1.O=CO.O=CO |
| InChI | InChI=1S/C5H7NO2.2CH2O2/c7-4-2-1-3-5(8)6-4;2*2-1-3/h1-3H2,(H,6,7,8);2*1H,(H,2,3) |
| InChIKey | VTCGGVDMADXBPN-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze formic acid;piperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;piperidine-2,6-dione?
The IUPAC name of formic acid;piperidine-2,6-dione (CID 175983353) is formic acid;piperidine-2,6-dione.
What is the SMILES notation for formic acid;piperidine-2,6-dione?
The canonical SMILES for formic acid;piperidine-2,6-dione is O=C1CCCC(=O)N1.O=CO.O=CO.
What is the InChIKey of formic acid;piperidine-2,6-dione?
The InChIKey is VTCGGVDMADXBPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2.2CH2O2/c7-4-2-1-3-5(8)6-4;2*2-1-3/h1-3H2,(H,6,7,8);2*1H,(H,2,3).
What are the key properties of formic acid;piperidine-2,6-dione?
formic acid;piperidine-2,6-dione has a molecular weight of 205.17 g/mol, XLogP of -0.79, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;piperidine-2,6-dione is sourced from PubChem (CID 175983353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).