About 2-(2,7-diazaspiro[3.4]octan-5-yl)-1,3,4-oxadiazole
2-(2,7-diazaspiro[3.4]octan-5-yl)-1,3,4-oxadiazole (PubChem CID 175984101) has the molecular formula C8H12N4O
and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-(2,7-diazaspiro[3.4]octan-5-yl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-(2,7-diazaspiro[3.4]octan-5-yl)-1,3,4-oxadiazole |
| PubChem CID | 175984101 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 2-(2,7-diazaspiro[3.4]octan-5-yl)-1,3,4-oxadiazole |
| SMILES | c1nnc(C2CNCC23CNC3)o1 |
| InChI | InChI=1S/C8H12N4O/c1-6(7-12-11-5-13-7)8(2-9-1)3-10-4-8/h5-6,9-10H,1-4H2 |
| InChIKey | VDKSHNCYEVMVAY-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,7-diazaspiro[3.4]octan-5-yl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,7-diazaspiro[3.4]octan-5-yl)-1,3,4-oxadiazole?
The IUPAC name of 2-(2,7-diazaspiro[3.4]octan-5-yl)-1,3,4-oxadiazole (CID 175984101) is 2-(2,7-diazaspiro[3.4]octan-5-yl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-(2,7-diazaspiro[3.4]octan-5-yl)-1,3,4-oxadiazole?
The canonical SMILES for 2-(2,7-diazaspiro[3.4]octan-5-yl)-1,3,4-oxadiazole is c1nnc(C2CNCC23CNC3)o1.
What is the InChIKey of 2-(2,7-diazaspiro[3.4]octan-5-yl)-1,3,4-oxadiazole?
The InChIKey is VDKSHNCYEVMVAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O/c1-6(7-12-11-5-13-7)8(2-9-1)3-10-4-8/h5-6,9-10H,1-4H2.
What are the key properties of 2-(2,7-diazaspiro[3.4]octan-5-yl)-1,3,4-oxadiazole?
2-(2,7-diazaspiro[3.4]octan-5-yl)-1,3,4-oxadiazole has a molecular weight of 180.21 g/mol, XLogP of -0.65, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,7-diazaspiro[3.4]octan-5-yl)-1,3,4-oxadiazole is sourced from PubChem (CID 175984101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).