About methyl (2S)-3-hydroxy-3-methyl-2-(methylamino)butanoate;2,2,2-trifluoroacetic acid
methyl (2S)-3-hydroxy-3-methyl-2-(methylamino)butanoate;2,2,2-trifluoroacetic acid (PubChem CID 175987432) has the molecular formula C9H16F3NO5
and a molecular weight of 275.22 g/mol. Its IUPAC name is methyl (2S)-3-hydroxy-3-methyl-2-(methylamino)butanoate;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | methyl (2S)-3-hydroxy-3-methyl-2-(methylamino)butanoate;2,2,2-trifluoroacetic acid |
| PubChem CID | 175987432 |
| Molecular Formula | C9H16F3NO5 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | methyl (2S)-3-hydroxy-3-methyl-2-(methylamino)butanoate;2,2,2-trifluoroacetic acid |
| SMILES | CN[C@H](C(=O)OC)C(C)(C)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H15NO3.C2HF3O2/c1-7(2,10)5(8-3)6(9)11-4;3-2(4,5)1(6)7/h5,8,10H,1-4H3;(H,6,7)/t5-;/m1./s1 |
| InChIKey | CALKWGNJJCELQB-NUBCRITNSA-N |
| XLogP | 0.15 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2S)-3-hydroxy-3-methyl-2-(methylamino)butanoate;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-3-hydroxy-3-methyl-2-(methylamino)butanoate;2,2,2-trifluoroacetic acid?
The IUPAC name of methyl (2S)-3-hydroxy-3-methyl-2-(methylamino)butanoate;2,2,2-trifluoroacetic acid (CID 175987432) is methyl (2S)-3-hydroxy-3-methyl-2-(methylamino)butanoate;2,2,2-trifluoroacetic acid.
What is the SMILES notation for methyl (2S)-3-hydroxy-3-methyl-2-(methylamino)butanoate;2,2,2-trifluoroacetic acid?
The canonical SMILES for methyl (2S)-3-hydroxy-3-methyl-2-(methylamino)butanoate;2,2,2-trifluoroacetic acid is CN[C@H](C(=O)OC)C(C)(C)O.O=C(O)C(F)(F)F.
What is the InChIKey of methyl (2S)-3-hydroxy-3-methyl-2-(methylamino)butanoate;2,2,2-trifluoroacetic acid?
The InChIKey is CALKWGNJJCELQB-NUBCRITNSA-N. The full InChI is InChI=1S/C7H15NO3.C2HF3O2/c1-7(2,10)5(8-3)6(9)11-4;3-2(4,5)1(6)7/h5,8,10H,1-4H3;(H,6,7)/t5-;/m1./s1.
What are the key properties of methyl (2S)-3-hydroxy-3-methyl-2-(methylamino)butanoate;2,2,2-trifluoroacetic acid?
methyl (2S)-3-hydroxy-3-methyl-2-(methylamino)butanoate;2,2,2-trifluoroacetic acid has a molecular weight of 275.22 g/mol, XLogP of 0.15, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-3-hydroxy-3-methyl-2-(methylamino)butanoate;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 175987432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).