C33H40N2O3 — CID 175987458
2-[2-[2-[6-(diethylamino)-2,3-dihydro-1H-xanthen-4-yl]ethenyl]-3,3-dimethyl-2H-indol-1-yl]ethyl acetate (PubChem CID 175987458) has the molecular formula C33H40N2O3 and a molecular weight of 512.69 g/mol. Its IUPAC name is 2-[2-[2-[6-(diethylamino)-2,3-dihydro-1H-xanthen-4-yl]ethenyl]-3,3-dimethyl-2H-indol-1-yl]ethyl acetate.
| Compound Name | 2-[2-[2-[6-(diethylamino)-2,3-dihydro-1H-xanthen-4-yl]ethenyl]-3,3-dimethyl-2H-indol-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 175987458 |
| Molecular Formula | C33H40N2O3 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | 2-[2-[2-[6-(diethylamino)-2,3-dihydro-1H-xanthen-4-yl]ethenyl]-3,3-dimethyl-2H-indol-1-yl]ethyl acetate |
| SMILES | CCN(CC)c1ccc2c(c1)OC1=C(C=CC3N(CCOC(C)=O)c4ccccc4C3(C)C)CCCC1=C2 |
| InChI | InChI=1S/C33H40N2O3/c1-6-34(7-2)27-17-15-25-21-26-12-10-11-24(32(26)38-30(25)22-27)16-18-31-33(4,5)28-13-8-9-14-29(28)35(31)19-20-37-23(3)36/h8-9,13-18,21-22,31H,6-7,10-12,19-20H2,1-5H3 |
| InChIKey | QYCNFUJFSLWCEJ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|