C21H27N3O4 — CID 175987475
1-[6-[(3R,5S)-1-ethyl-5-methylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 175987475) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 1-[6-[(3R,5S)-1-ethyl-5-methylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 1-[6-[(3R,5S)-1-ethyl-5-methylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175987475 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 1-[6-[(3R,5S)-1-ethyl-5-methylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCN1C[C@@H](C)C[C@@H](Oc2ccc3c(c2)CN(N2C(=O)CCCC2=O)C3=O)C1 |
| InChI | InChI=1S/C21H27N3O4/c1-3-22-11-14(2)9-17(13-22)28-16-7-8-18-15(10-16)12-23(21(18)27)24-19(25)5-4-6-20(24)26/h7-8,10,14,17H,3-6,9,11-13H2,1-2H3/t14-,17+/m0/s1 |
| InChIKey | QETYZRVWYLYKJZ-WMLDXEAASA-N |
| XLogP | 2.21 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|