C32H24F3N2O3P — CID 175987644
methyl 4-[1-[(2-diphenylphosphanylphenyl)methyl]-6-oxopyridazin-3-yl]-2-(trifluoromethyl)benzoate (PubChem CID 175987644) has the molecular formula C32H24F3N2O3P and a molecular weight of 572.52 g/mol. Its IUPAC name is methyl 4-[1-[(2-diphenylphosphanylphenyl)methyl]-6-oxopyridazin-3-yl]-2-(trifluoromethyl)benzoate.
| Compound Name | methyl 4-[1-[(2-diphenylphosphanylphenyl)methyl]-6-oxopyridazin-3-yl]-2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 175987644 |
| Molecular Formula | C32H24F3N2O3P |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | methyl 4-[1-[(2-diphenylphosphanylphenyl)methyl]-6-oxopyridazin-3-yl]-2-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(=O)n(Cc3ccccc3P(c3ccccc3)c3ccccc3)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C32H24F3N2O3P/c1-40-31(39)26-17-16-22(20-27(26)32(33,34)35)28-18-19-30(38)37(36-28)21-23-10-8-9-15-29(23)41(24-11-4-2-5-12-24)25-13-6-3-7-14-25/h2-20H,21H2,1H3 |
| InChIKey | NTFWBYQCNYJEDW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|